CymitQuimica logo

CAS 170572-47-1

:

3,5-difluoro-4-hydroxybenzoic acid methyl ester

Description:
3,5-Difluoro-4-hydroxybenzoic acid methyl ester is an organic compound characterized by the presence of a benzoic acid structure substituted with two fluorine atoms at the 3 and 5 positions and a hydroxy group at the 4 position. The methyl ester functional group indicates that the carboxylic acid has been esterified with methanol, enhancing its solubility in organic solvents. This compound is typically a white to off-white solid and is soluble in polar organic solvents. Its fluorinated structure may impart unique chemical properties, such as increased lipophilicity and altered reactivity, making it of interest in various fields, including pharmaceuticals and agrochemicals. The presence of the hydroxy group suggests potential for hydrogen bonding, which can influence its interactions in biological systems. Additionally, the compound may exhibit specific biological activities, although detailed studies would be necessary to elucidate its pharmacological profile. Safety data should be consulted for handling and usage, as fluorinated compounds can have distinct environmental and health implications.
Formula:C8H6F2O3
InChI:InChI=1S/C8H6F2O3/c1-13-8(12)4-2-5(9)7(11)6(10)3-4/h2-3,11H,1H3
InChI key:GNFQIZAZPRYIFJ-UHFFFAOYSA-N
SMILES:COC(=O)C1=CC(=C(C(=C1)F)O)F
Synonyms:
  • Benzoic acid, 3,5-difluoro-4-hydroxy-, methyl ester
Found 5 products.