CAS 1706-12-3
:1-Methyl-4-phenoxybenzene
Description:
1-Methyl-4-phenoxybenzene, also known as p-phenoxy-toluene, is an organic compound characterized by its aromatic structure, which includes a methyl group and a phenoxy group attached to a benzene ring. This compound typically appears as a colorless to pale yellow liquid with a distinct aromatic odor. It is relatively non-polar, making it soluble in organic solvents but less so in water. The presence of both the methyl and phenoxy groups contributes to its chemical reactivity, allowing it to participate in various substitution reactions. 1-Methyl-4-phenoxybenzene is primarily used in the synthesis of other organic compounds and may serve as an intermediate in the production of agrochemicals, pharmaceuticals, or specialty chemicals. Its physical properties, such as boiling point and melting point, are influenced by the molecular structure and the interactions between the aromatic rings. Safety data indicates that, like many aromatic compounds, it should be handled with care due to potential health hazards associated with inhalation or skin contact.
Formula:C13H12O
InChI:InChI=1S/C13H12O/c1-11-7-9-13(10-8-11)14-12-5-3-2-4-6-12/h2-10H,1H3
InChI key:InChIKey=SSTNIXFHCIOCJI-UHFFFAOYSA-N
SMILES:O(C1=CC=C(C)C=C1)C2=CC=CC=C2
Synonyms:- 1-Methyl-4-Phenoxybenzene
- 4-Methyldiphenyl ether
- 4-Methylphenyl phenyl ether
- 4-Phenoxytoluene
- Benzene, 1-methyl-4-phenoxy-
- Ether, phenyl p-tolyl
- Ether, phenyl p-tolyl (8CI)
- Nsc 83594
- Phenyl p-tolyl ether
- p-Cresol phenyl ether
- p-Methylphenyl phenyl ether
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Methyl-4-phenoxy-benzene
CAS:Formula:C13H12OPurity:98%Color and Shape:LiquidMolecular weight:184.23381-Methyl-4-phenoxybenzene
CAS:<p>1-Methyl-4-phenoxybenzene is a monomer that is used in the synthesis of polymers and plastics. It reacts with sulfur and pentamethylbenzene to form 1,3-diphenyl ethers. This reaction takes place in three steps: methylation, radical mechanism, and nucleophilic substitution. The first step involves the addition of a methyl group to a double bond of an arene. The second step is the addition of chlorine to the molecule, which forms radicals that can react with other molecules. The third step is nucleophilic substitution, where a halide leaves the molecule to be replaced by another atom or group. 1-Methyl-4-phenoxybenzene can also be used as a reagent for the conversion of nitrobenzenes into amines.</p>Formula:C13H12OPurity:Min. 95%Color and Shape:LiquidMolecular weight:184.23 g/mol1-Methyl-4-phenoxybenzene
CAS:Formula:C13H12OPurity:98%Color and Shape:LiquidMolecular weight:184.238
