CAS 1706-81-6
:5-NITRO-2-METHOXY-1-ISOPROPYLBENZOL
Description:
5-Nitro-2-methoxy-1-isopropylbenzene, with the CAS number 1706-81-6, is an organic compound characterized by its aromatic structure, which includes a nitro group (-NO2), a methoxy group (-OCH3), and an isopropyl group (-C3H7) attached to a benzene ring. This compound typically exhibits a yellow to brown color and is likely to be a solid at room temperature. Its molecular structure suggests it may have moderate polarity due to the presence of the methoxy and nitro groups, influencing its solubility in various solvents. The nitro group can impart certain reactivity, making it a potential candidate for further chemical transformations. Additionally, the presence of the isopropyl group may affect its steric hindrance and overall reactivity. As with many nitro-substituted aromatic compounds, it may exhibit specific biological activities or toxicological properties, necessitating careful handling and assessment in laboratory settings. Overall, this compound's unique functional groups contribute to its chemical behavior and potential applications in organic synthesis or material science.
Formula:C10H13NO3
InChI:InChI=1/C10H13NO3/c1-7(2)9-6-8(11(12)13)4-5-10(9)14-3/h4-7H,1-3H3
SMILES:CC(C)c1cc(ccc1OC)N(=O)=O
Synonyms:- 5-Nitro-2-Methoxy-1-Isopropylbezol
- 1-Methoxy-2-(1-Methylethyl)-4-Nitrobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-Isopropyl-1-methoxy-4-nitrobenzene
CAS:Formula:C10H13NO3Color and Shape:SolidMolecular weight:195.21512-Isopropyl-1-methoxy-4-nitro-benzene
CAS:Controlled ProductApplications 2-Isopropyl-1-methoxy-4-nitro-benzene (cas# 1706-81-6) is a useful research chemical.
Formula:C10H13NO3Color and Shape:NeatMolecular weight:195.22

