CAS 17060-81-0

N-(4-bromo-2,6-dimethylphenyl)-N~2~,N~2~-diethylglycinamide

Description:

N-(4-bromo-2,6-dimethylphenyl)-N',N'-diethylglycinamide, with the CAS number 17060-81-0, is a chemical compound that belongs to the class of glycinamides. This substance features a bromo-substituted aromatic ring, which contributes to its unique chemical properties, including potential reactivity and biological activity. The presence of two ethyl groups attached to the nitrogen atoms enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. The dimethyl substitution on the aromatic ring may also affect its steric hindrance and electronic properties, which can be significant in pharmacological contexts. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its structural characteristics suggest potential interactions with biological targets, although specific biological effects would require empirical investigation. As with many organic compounds, safety and handling precautions should be observed, given the presence of bromine, which can pose health risks.

Formula: C₁₄H₂₁BrN₂O

InChI: InChI=1/C14H21BrN2O/c1-5-17(6-2)9-13(18)16-14-10(3)7-12(15)8-11(14)4/h7-8H,5-6,9H2,1-4H3,(H,16,18)

SMILES: CCN(CC)CC(=Nc1c(C)cc(cc1C)Br)O

4'-Bromo-2-(diethylamino)-2',6'-acetoxylidide

CAS: 17060-81-0

Please enquire for more information about 4'-Bromo-2-(diethylamino)-2',6'-acetoxylidide including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₄H₂₁BrN₂O

Purity: Min. 95%

Molecular weight: 313.23 g/mol

Ref: 3D-SAA06081