CAS 170632-47-0
:Lificiguat
Description:
Lificiguat, with the CAS number 170632-47-0, is a chemical compound that functions primarily as a soluble guanylate cyclase (sGC) stimulator. It is characterized by its ability to enhance the nitric oxide (NO) signaling pathway, which plays a crucial role in various physiological processes, including vasodilation and blood flow regulation. Lificiguat is often explored for its therapeutic potential in treating conditions such as pulmonary hypertension and heart failure. The compound exhibits a favorable pharmacokinetic profile, allowing for oral administration and effective systemic absorption. Its mechanism of action involves the activation of sGC, leading to increased levels of cyclic guanosine monophosphate (cGMP), which mediates smooth muscle relaxation. Additionally, Lificiguat has been studied for its safety and efficacy in clinical trials, demonstrating a manageable side effect profile. Overall, Lificiguat represents a promising avenue in cardiovascular pharmacotherapy, with ongoing research aimed at fully elucidating its therapeutic applications and benefits.
Formula:C19H16N2O2
InChI:InChI=1S/C19H16N2O2/c22-13-15-10-11-18(23-15)19-16-8-4-5-9-17(16)21(20-19)12-14-6-2-1-3-7-14/h1-11,22H,12-13H2
InChI key:InChIKey=OQQVFCKUDYMWGV-UHFFFAOYSA-N
SMILES:C(N1N=C(C=2C1=CC=CC2)C=3OC(CO)=CC3)C4=CC=CC=C4
Synonyms:- 1-Benzyl-3-(5-hydroxymethyl-furan-2-yl)indazole
- 1-Benzyl-3-(5-hydroxymethylfur-2-yl)indazole
- 2-Furanmethanol, 5-[1-(phenylmethyl)-1H-indazol-3-yl]-
- 5-[1-(Phenylmethyl)-1H-Indazol-3-Yl]-2-Furanmethanol
- Lificiguat
- YC 1 (pharmaceutical)
- Yc-1 (3-(5'-Hydroxymethyl-2'-Furyl)-1-Be Nzyl Indazole) \ Guanylyl Cyclase Acti
- [5-(1-Benzyl-1H-indazol-3-yl)-furan-2-yl]-methanol
- [5-(1-Benzylindazol-3-yl)furan-2-yl]methanol
- YC 1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
(5-(1-Benzyl-1H-Indazol-3-Yl)Furan-2-Yl)Methanol
CAS:(5-(1-Benzyl-1H-Indazol-3-Yl)Furan-2-Yl)MethanolPurity:98%Molecular weight:304.34g/molYC-1
CAS:Formula:C19H16N2O2Purity:>98.0%(HPLC)(qNMR)Color and Shape:White to Light yellow powder to crystalMolecular weight:304.35Lificiguat
CAS:Lificiguat (YC-1) is an nitric oxide (NO)-independent activator of soluble guanylyl cyclase(sGC) and an inhibitor of Hypoxia-inducible factor-1alpha (HIF-1alphaFormula:C19H16N2O2Purity:98.85% - 99.92%Color and Shape:SolidMolecular weight:304.34Ref: TM-T4381
2mg34.00€5mg49.00€1mL*10mM (DMSO)50.00€10mg64.00€25mg128.00€50mg227.00€100mg393.00€200mg695.00€YC-1
CAS:YC-1 is an activator of soluble guanylate cyclase (sGC), derived from synthetic chemical sources, with a specific mode of action that inhibits the degradation of cyclic guanosine monophosphate (cGMP). By modulating the levels of cGMP, YC-1 affects various biological pathways associated with vasodilation, anti-platelet aggregation, and anti-inflammatory effects.Formula:C19H16N2O2Purity:Min. 95%Molecular weight:304.34 g/mol





