CAS 1706419-04-6

4-(1H-Imidazol-1-yl)-2-methyl-6-(1-piperazinyl)pyrimidine

Description:

4-(1H-Imidazol-1-yl)-2-methyl-6-(1-piperazinyl)pyrimidine is a chemical compound characterized by its complex structure, which includes a pyrimidine ring substituted with both an imidazole and a piperazine moiety. This compound typically exhibits properties such as moderate solubility in polar solvents, which is influenced by the presence of nitrogen-containing heterocycles that can engage in hydrogen bonding. The imidazole and piperazine groups contribute to its potential biological activity, making it of interest in pharmaceutical research, particularly in the development of compounds targeting various biological pathways. The presence of multiple nitrogen atoms in its structure may also enhance its ability to interact with biological targets, such as enzymes or receptors. Additionally, the compound's molecular geometry and electronic properties can influence its reactivity and stability, making it a subject of study in medicinal chemistry. Overall, this compound exemplifies the diverse functionalities that can arise from heterocyclic chemistry, with potential applications in drug discovery and development.

Formula: C₁₂H₁₆N₆

InChI: InChI=1S/C12H16N6/c1-10-15-11(17-5-2-13-3-6-17)8-12(16-10)18-7-4-14-9-18/h4,7-9,13H,2-3,5-6H2,1H3

InChI key: InChIKey=CFIPNCBGJHKLRO-UHFFFAOYSA-N

SMILES: CC=1N=C(C=C(N1)N2CCNCC2)N3C=CN=C3

Synonyms:

• 4-(1H-Imidazol-1-yl)-2-methyl-6-(1-piperazinyl)pyrimidine
• Pyrimidine, 4-(1H-imidazol-1-yl)-2-methyl-6-(1-piperazinyl)-