CAS 170642-27-0
:Fmoc-D-Abu-OH
Description:
Fmoc-D-Abu-OH, or 9-fluorenylmethoxycarbonyl-D-α-aminobutyric acid, is a protected amino acid commonly used in peptide synthesis. The Fmoc (9-fluorenylmethoxycarbonyl) group serves as a protective group for the amino functionality, allowing for selective reactions during the synthesis process. This compound features a D-α-aminobutyric acid backbone, which is a non-proteinogenic amino acid that can introduce unique structural properties into peptides. Fmoc-D-Abu-OH is typically characterized by its stability under basic conditions and its ability to be deprotected under mild acidic conditions, making it suitable for solid-phase peptide synthesis. Its solubility is generally good in organic solvents, which facilitates its use in various synthetic protocols. The presence of the bulky Fmoc group can influence the conformation and overall properties of the resulting peptides, potentially affecting their biological activity. Overall, Fmoc-D-Abu-OH is a valuable building block in the field of peptide chemistry, particularly for the synthesis of peptides with specific structural and functional characteristics.
Formula:C19H19NO4
InChI:InChI=1/C19H19NO4/c1-2-17(18(21)22)20-19(23)24-11-16-14-9-5-3-7-12(14)13-8-4-6-10-15(13)16/h3-10,16-17H,2,11H2,1H3,(H,20,23)(H,21,22)/t17-/m1/s1
SMILES:CC[C@H](C(=O)O)N=C(O)OCC1c2ccccc2c2ccccc12
Synonyms:- Fmoc-D-2-Abu-OH
- (2R)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}butanoic acid
- Fmoc-D-2-aminobutyric acid
- (R)-Fmoc-2-aminobutyric acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(R)-2-(Fmoc-amino)butyric acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C19H19NO4Purity:98%Color and Shape:SolidMolecular weight:325.36Fmoc-D-Abu-OH
CAS:Bachem ID: 4027306.
Formula:C19H19NO4Purity:99.3%Color and Shape:White PowderMolecular weight:325.36(R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)butanoic acid
CAS:(R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)butanoic acidFormula:C19H19NO4Purity:98%Color and Shape: white powderMolecular weight:325.36g/molFmoc-D-Abu-OH
CAS:M06084 - Fmoc-D-Abu-OH
Formula:C19H19NO4Purity:95%Color and Shape:SolidMolecular weight:325.364





