CymitQuimica logo

CAS 1706434-99-2

:

3-Bromo-6-(3-fluorophenyl)isothiazolo[5,4-b]pyridine

Description:
3-Bromo-6-(3-fluorophenyl)isothiazolo[5,4-b]pyridine is a heterocyclic compound characterized by the presence of both isothiazole and pyridine rings, which contribute to its unique chemical properties. The compound features a bromine atom and a fluorophenyl group, which can influence its reactivity and biological activity. Typically, such compounds exhibit significant pharmacological potential, often being investigated for their roles in medicinal chemistry, particularly in the development of new therapeutic agents. The presence of halogens like bromine and fluorine can enhance lipophilicity and alter the electronic properties of the molecule, potentially affecting its interaction with biological targets. Additionally, the isothiazolo and pyridine moieties may contribute to the compound's ability to engage in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Overall, 3-Bromo-6-(3-fluorophenyl)isothiazolo[5,4-b]pyridine represents a complex structure with promising applications in drug discovery and development.
Formula:C12H6BrFN2S
InChI:InChI=1S/C12H6BrFN2S/c13-11-9-4-5-10(15-12(9)17-16-11)7-2-1-3-8(14)6-7/h1-6H
InChI key:InChIKey=LNAZOJKQLRRXEW-UHFFFAOYSA-N
SMILES:BrC=1C=2C(=NC(=CC2)C3=CC(F)=CC=C3)SN1
Synonyms:
  • Isothiazolo[5,4-b]pyridine, 3-bromo-6-(3-fluorophenyl)-
  • 3-Bromo-6-(3-fluorophenyl)isothiazolo[5,4-b]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.