CAS 1706435-18-8

3,3-Dimethyl-2-oxa-7-azaspiro[4.4]nonane

Description:

3,3-Dimethyl-2-oxa-7-azaspiro[4.4]nonane is a chemical compound characterized by its unique spirocyclic structure, which consists of a nitrogen atom and an oxygen atom incorporated into a bicyclic framework. This compound features two methyl groups attached to the carbon backbone, contributing to its steric properties and potentially influencing its reactivity and interactions. The presence of the nitrogen atom suggests that it may exhibit basicity and could participate in hydrogen bonding, while the oxygen atom may contribute to its polarity and solubility in various solvents. The spirocyclic nature of the molecule often results in interesting conformational dynamics, which can affect its biological activity and chemical behavior. Such compounds are of interest in medicinal chemistry and materials science due to their potential applications in drug development and as building blocks for more complex molecular architectures. Overall, 3,3-Dimethyl-2-oxa-7-azaspiro[4.4]nonane represents a fascinating example of a heterocyclic compound with diverse potential applications.

Formula: C₉H₁₇NO

InChI: InChI=1S/C9H17NO/c1-8(2)5-9(7-11-8)3-4-10-6-9/h10H,3-7H2,1-2H3

InChI key: InChIKey=VLVLCKNPSNJGDP-UHFFFAOYSA-N

SMILES: CC1(C)CC2(CO1)CCNC2

Synonyms:

• 3,3-Dimethyl-2-oxa-7-azaspiro[4.4]nonane
• 2-Oxa-7-azaspiro[4.4]nonane, 3,3-dimethyl-