CAS 1706453-27-1

4-[(4-Chlorophenyl)sulfonyl]butanoyl chloride

Description:

4-[(4-Chlorophenyl)sulfonyl]butanoyl chloride is an organic compound characterized by the presence of a butanoyl chloride moiety attached to a sulfonyl group, which is further substituted with a 4-chlorophenyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its reactivity, particularly due to the presence of the acyl chloride functional group, which makes it a potent electrophile in various chemical reactions, including acylation and sulfonylation. The sulfonyl group enhances its solubility in polar solvents, while the chlorophenyl group can influence its electronic properties and reactivity. This compound is often utilized in synthetic organic chemistry for the preparation of more complex molecules, including pharmaceuticals and agrochemicals. Safety precautions are necessary when handling this substance, as it may be corrosive and can release harmful gases upon reaction with water or moisture.

Formula: C₁₀H₁₀Cl₂O₃S

InChI: InChI=1S/C10H10Cl2O3S/c11-8-3-5-9(6-4-8)16(14,15)7-1-2-10(12)13/h3-6H,1-2,7H2

InChI key: InChIKey=CQDAWSYWUVSKLM-UHFFFAOYSA-N

SMILES: S(CCCC(Cl)=O)(=O)(=O)C1=CC=C(Cl)C=C1

Synonyms:

• Butanoyl chloride, 4-[(4-chlorophenyl)sulfonyl]-
• 4-[(4-Chlorophenyl)sulfonyl]butanoyl chloride

4-((4-chlorophenyl)sulfonyl)butanoyl chloride

CAS: 1706453-27-1

Formula: C₁₀H₁₀Cl₂O₃S

Purity: 95.0%

Molecular weight: 281.15

Ref: 10-F495546