
CAS 1706455-38-0
:4,6-Dichloro-5-cyclobutyl-2-(trifluoromethyl)pyrimidine
Description:
4,6-Dichloro-5-cyclobutyl-2-(trifluoromethyl)pyrimidine is a heterocyclic organic compound characterized by its pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of two chlorine atoms at positions 4 and 6 contributes to its reactivity and potential applications in medicinal chemistry. The cyclobutyl group at position 5 introduces a cyclic aliphatic structure, which can influence the compound's steric and electronic properties. Additionally, the trifluoromethyl group at position 2 enhances lipophilicity and metabolic stability, making it a valuable moiety in drug design. This compound may exhibit biological activity, potentially serving as a lead compound in the development of pharmaceuticals. Its unique combination of functional groups suggests that it could interact with various biological targets, although specific biological activities would require empirical investigation. Overall, 4,6-Dichloro-5-cyclobutyl-2-(trifluoromethyl)pyrimidine represents a complex structure with potential applications in chemical synthesis and drug discovery.
Formula:C9H7Cl2F3N2
InChI:InChI=1S/C9H7Cl2F3N2/c10-6-5(4-2-1-3-4)7(11)16-8(15-6)9(12,13)14/h4H,1-3H2
InChI key:InChIKey=IJNKNMIPHNTWLW-UHFFFAOYSA-N
SMILES:ClC=1C(=C(Cl)N=C(C(F)(F)F)N1)C2CCC2
Synonyms:- 4,6-Dichloro-5-cyclobutyl-2-(trifluoromethyl)pyrimidine
- Pyrimidine, 4,6-dichloro-5-cyclobutyl-2-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.