
CAS 170686-12-1
:N-[5-[(1R)-2-[[Bis[4-(difluoromethoxy)phenyl]methyl]amino]-1-hydroxyethyl]-2-hydroxyphenyl]methanesulfonamide
Description:
N-[5-[(1R)-2-[[Bis[4-(difluoromethoxy)phenyl]methyl]amino]-1-hydroxyethyl]-2-hydroxyphenyl]methanesulfonamide, with CAS number 170686-12-1, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple functional groups such as sulfonamide, hydroxyl, and amine. This compound is typically classified as a pharmaceutical agent, often investigated for its potential therapeutic applications. Its structure suggests it may exhibit significant biological activity, possibly acting as an inhibitor or modulator in various biochemical pathways. The presence of difluoromethoxy groups may enhance its lipophilicity and influence its pharmacokinetic properties. Additionally, the stereochemistry indicated by the (1R) configuration suggests that the compound may have specific interactions with biological targets, which can be crucial for its efficacy and safety profile. As with many synthetic compounds, its solubility, stability, and reactivity can vary based on environmental conditions, making it essential to consider these factors in practical applications.
Formula:C24H24F4N2O6S
InChI:InChI=1S/C24H24F4N2O6S/c1-37(33,34)30-19-12-16(6-11-20(19)31)21(32)13-29-22(14-2-7-17(8-3-14)35-23(25)26)15-4-9-18(10-5-15)36-24(27)28/h2-12,21-24,29-32H,13H2,1H3/t21-/m0/s1
InChI key:InChIKey=FUKHGCVTMAEHRG-NRFANRHFSA-N
SMILES:C(NC[C@H](O)C1=CC(NS(C)(=O)=O)=C(O)C=C1)(C2=CC=C(OC(F)F)C=C2)C3=CC=C(OC(F)F)C=C3
Synonyms:- N-[5-[(1R)-2-[[Bis[4-(difluoromethoxy)phenyl]methyl]amino]-1-hydroxyethyl]-2-hydroxyphenyl]methanesulfonamide
- Methanesulfonamide, N-[5-[2-[[bis[4-(difluoromethoxy)phenyl]methyl]amino]-1-hydroxyethyl]-2-hydroxyphenyl]-, (R)-
- Methanesulfonamide, N-[5-[(1R)-2-[[bis[4-(difluoromethoxy)phenyl]methyl]amino]-1-hydroxyethyl]-2-hydroxyphenyl]-
- BMS 194449
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
BMS-194449
CAS:BMS-194449 is a full beta 3 agonist.Formula:C24H24F4N2O6SColor and Shape:SolidMolecular weight:544.52
