CAS 170699-07-7
:METHYL 2-ACETAMIDO-3-(3,4-DIACETOXYPHENYL)-2-PROPENOATE
Description:
Methyl 2-acetamido-3-(3,4-diacetoxyphenyl)-2-propenoate, with the CAS number 170699-07-7, is an organic compound characterized by its complex structure, which includes an acetamido group and a diacetoxyphenyl moiety attached to a propenoate backbone. This compound typically exhibits properties associated with esters and amides, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The diacetoxyphenyl group may impart specific electronic and steric effects, influencing its reactivity and interactions in chemical reactions. Methyl 2-acetamido-3-(3,4-diacetoxyphenyl)-2-propenoate may be of interest in medicinal chemistry and organic synthesis, particularly in the development of pharmaceuticals or as an intermediate in chemical reactions. Its unique structure suggests potential applications in various fields, including drug design and materials science, although specific biological activities or applications would require further investigation. Safety and handling precautions should be observed, as with any chemical substance, due to potential hazards associated with its use.
Formula:C16H17NO7
InChI:InChI=1/C16H17NO7/c1-9(18)17-13(16(21)22-4)7-12-5-6-14(23-10(2)19)15(8-12)24-11(3)20/h5-8H,1-4H3,(H,17,18)/b13-7-
SMILES:CC(=N/C(=C\c1ccc(c(c1)OC(=O)C)OC(=O)C)/C(=O)OC)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methyl 2-Acetamido-3-(3,4-diacetoxyphenyl)-2-propenoate
CAS:Controlled Product<p>Applications Methyl 2-Acetamido-3-(3,4-diacetoxyphenyl)-2-propenoate (cas# 170699-07-7) is a compound useful in organic synthesis.<br></p>Formula:C16H17NO7Color and Shape:NeatMolecular weight:335.31
