CAS 1707-92-2: Tris(phenylmethyl) phosphate

Description:Tris(phenylmethyl) phosphate, with the CAS number 1707-92-2, is an organophosphate compound characterized by its three phenylmethyl groups attached to a phosphate backbone. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its use as a plasticizer and flame retardant in various applications, particularly in polymers and resins. The presence of the phenylmethyl groups contributes to its hydrophobic nature, enhancing its compatibility with organic materials. Tris(phenylmethyl) phosphate exhibits moderate toxicity and potential environmental persistence, necessitating careful handling and disposal. Its chemical structure allows for significant thermal stability, making it suitable for high-temperature applications. Additionally, it has low volatility, which reduces the risk of inhalation exposure. Overall, this compound plays a crucial role in industrial applications, but its environmental and health impacts warrant attention in its usage and regulation.

Formula:C₂₁H₂₁O₄P

InChI:InChI=1S/C21H21O4P/c22-26(23-16-19-10-4-1-5-11-19,24-17-20-12-6-2-7-13-20)25-18-21-14-8-3-9-15-21/h1-15H,16-18H2

InChI key:InChIKey=OACSUWPJZKGHHK-UHFFFAOYSA-N

SMILES:O=P(OCC=1C=CC=CC1)(OCC=2C=CC=CC2)OCC=3C=CC=CC3