CAS 17070-58-5
:1-BENZOFURAN-2-SULFONYL CHLORIDE
Description:
1-Benzofuran-2-sulfonyl chloride, with the CAS number 17070-58-5, is an organic compound characterized by the presence of a benzofuran moiety attached to a sulfonyl chloride functional group. This compound typically appears as a white to light yellow solid and is known for its reactivity due to the sulfonyl chloride group, which can undergo nucleophilic substitution reactions. It is soluble in organic solvents such as dichloromethane and chloroform but is generally insoluble in water. The sulfonyl chloride functionality makes it a useful intermediate in organic synthesis, particularly in the preparation of sulfonamides and other sulfonyl derivatives. Additionally, it can serve as a reagent in various chemical transformations, including acylation and the introduction of sulfonyl groups into other organic molecules. Due to its reactive nature, proper handling and storage under inert conditions are recommended to prevent hydrolysis and degradation. Safety precautions should be observed, as it can be corrosive and may cause irritation upon contact with skin or mucous membranes.
Formula:C8H5ClO3S
InChI:InChI=1/C8H5ClO3S/c9-13(10,11)8-5-6-3-1-2-4-7(6)12-8/h1-5H
SMILES:c1ccc2c(c1)cc(o2)S(=O)(=O)Cl
Synonyms:- 1-Benzofurane-2-sulfonylchloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Benzofuran-2-sulfonyl chloride
CAS:Formula:C8H5ClO3SPurity:%Color and Shape:SolidMolecular weight:216.6415Benzofuran-2-sulphonyl chloride
CAS:Benzofuran-2-sulphonyl chloridePurity:95%Color and Shape:Pale Yellow - Beige SolidMolecular weight:216.64g/mol1-Benzofuran-2-sulfonyl chloride
CAS:Formula:C8H5ClO3SPurity:95+%Color and Shape:CrystallineMolecular weight:216.641-Benzofuran-2-sulfonyl chloride
CAS:1-Benzofuran-2-sulfonyl chloride is a sulfinate that has efficient bond formation with nucleophiles. It is an important synthetic intermediate in organic chemistry, especially in the synthesis of heterocycles or peptides. The chemical reactions catalyzed by this compound include sulfonation, esterification, and substitution. This compound is used as a reagent to form bonds between two groups and also as a catalyst for organic reactions.
Formula:C8H5ClO3SPurity:Min. 95%Molecular weight:216.64 g/mol



