CAS 17070-70-1
:Chloro(3-isocyanatopropyl)dimethylsilane
Description:
Chloro(3-isocyanatopropyl)dimethylsilane, with the CAS number 17070-70-1, is an organosilicon compound characterized by the presence of both silane and isocyanate functional groups. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity, particularly due to the isocyanate group, which can participate in various chemical reactions, including nucleophilic addition and polymerization. The presence of the chlorosilane moiety allows for potential applications in surface modification and as a coupling agent in the synthesis of silicone-based materials. Its structure includes a dimethylsilane group, which contributes to its hydrophobic properties, making it useful in applications requiring water repellency. Additionally, the isocyanate functionality can react with amines, alcohols, and other nucleophiles, making it valuable in the production of polyurethane materials. However, due to the reactivity of isocyanates, appropriate safety measures should be taken when handling this compound, as it can be hazardous to health.
Formula:C6H12ClNOSi
InChI:InChI=1/C6H12ClNOSi/c1-10(2,7)5-3-4-8-6-9/h3-5H2,1-2H3
InChI key:InChIKey=LQJWIXKJNVDYHH-UHFFFAOYSA-N
SMILES:C(C[Si](C)(C)Cl)CN=C=O
Synonyms:- (3-Isocyanatopropyl)dimethylchlorosilane
- 3-(Dimethylchlorosilyl)propyl isocyanate
- 3-Isocyanaytopropyldimethylchlorosilane
- Chloro(3-Isocyanatopropyl)Dimethylsilane
- Isocyanic acid, 3-(chlorodimethylsilyl)propyl ester
- Silane, chloro(3-isocyanatopropyl)dimethyl-
- 3-(Dimethylchlorosilyl)propylisocyanate
- chloro(3-isocyanatopropyl)dimethyl-silan
- Isocyanatopropyldimethylchlorosilane
- 3-Iscyanatopropyldimethylchlorosilane
- Chlorodimethyl-(3-isocyanatopropyl)-silane
- 3-(Chlorodimethylsilyl)propyl isocyanate
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.