CAS 17073-35-7
:N-(3-Hydroxyphenyl)-N′-phenylthiourea
Description:
N-(3-Hydroxyphenyl)-N′-phenylthiourea, with the CAS number 17073-35-7, is an organic compound characterized by its thiourea functional group, which consists of a sulfur atom double-bonded to a carbon atom and single-bonded to two nitrogen atoms. This compound features a phenyl group and a 3-hydroxyphenyl substituent, contributing to its potential applications in various fields, including pharmaceuticals and agrochemicals. It typically exhibits properties such as moderate solubility in organic solvents and may show varying degrees of stability depending on environmental conditions. The presence of the hydroxyl group can influence its reactivity and interaction with other chemical species, potentially allowing for hydrogen bonding. Additionally, compounds of this nature may possess biological activity, making them of interest in medicinal chemistry. Overall, N-(3-Hydroxyphenyl)-N′-phenylthiourea is a versatile compound with unique structural characteristics that can be leveraged in synthetic and applied chemistry contexts.
Formula:C13H12N2OS
InChI:InChI=1S/C13H12N2OS/c16-12-8-4-7-11(9-12)15-13(17)14-10-5-2-1-3-6-10/h1-9,16H,(H2,14,15,17)
InChI key:InChIKey=BTFREYNHBKXMCJ-UHFFFAOYSA-N
SMILES:N(C(NC1=CC=CC=C1)=S)C2=CC(O)=CC=C2
Synonyms:- 1-(m-Hydroxyphenyl)-3-phenyl-2-thiourea
- N-Phenyl-N′-(3-hydroxyphenyl)thiourea
- Carbanilide, 3-hydroxythio-
- N-(3-Hydroxyphenyl)-N′-phenylthiourea
- Thiourea, N-(3-hydroxyphenyl)-N′-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
