CAS 1707358-54-0

Pyrimidine, 5-methyl-2-(3-pyrrolidinyloxy)-, hydrochloride (1:1)

Description:

Pyrimidine, 5-methyl-2-(3-pyrrolidinyloxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 1 and 3. The presence of a methyl group at the 5-position and a pyrrolidinyloxy substituent at the 2-position contributes to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The compound may exhibit biological activity, potentially influencing neurotransmitter systems or other physiological pathways, making it of interest in medicinal chemistry. Its structural features suggest it could interact with specific receptors or enzymes, although detailed pharmacological data would be necessary to elucidate its mechanisms of action. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₉H₁₃N₃O·ClH

InChI: InChI=1S/C9H13N3O.ClH/c1-7-4-11-9(12-5-7)13-8-2-3-10-6-8;/h4-5,8,10H,2-3,6H2,1H3;1H

InChI key: InChIKey=CKBDKLRIXWUGEB-UHFFFAOYSA-N

SMILES: O(C=1N=CC(C)=CN1)C2CCNC2.Cl

Synonyms:

• Pyrimidine, 5-methyl-2-(3-pyrrolidinyloxy)-, hydrochloride (1:1)

5-Methyl-2-(pyrrolidin-3-yloxy)pyrimidine hydrochloride

CAS: 1707358-54-0

Formula: C₉H₁₄ClN₃O

Molecular weight: 215.68

Ref: 10-F096479