CAS 1707361-87-2
:3-Cyclobutyl-4-fluoro-1H-indole
Description:
3-Cyclobutyl-4-fluoro-1H-indole is a synthetic organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a cyclobutyl group at the 3-position and a fluorine atom at the 4-position contributes to its unique chemical properties. This compound is likely to exhibit moderate lipophilicity due to the cyclobutyl moiety, which can influence its biological activity and solubility in organic solvents. The fluorine atom can enhance the compound's metabolic stability and may affect its interaction with biological targets. As an indole derivative, it may also exhibit potential pharmacological activities, making it of interest in medicinal chemistry. The compound's reactivity can be influenced by the electron-withdrawing nature of the fluorine atom, which can affect nucleophilic attack and other chemical transformations. Overall, 3-Cyclobutyl-4-fluoro-1H-indole represents a class of compounds that may have applications in drug discovery and development, particularly in the search for new therapeutic agents.
Formula:C12H12FN
InChI:InChI=1S/C12H12FN/c13-10-5-2-6-11-12(10)9(7-14-11)8-3-1-4-8/h2,5-8,14H,1,3-4H2
InChI key:InChIKey=ZAYYSXJKTZLNEV-UHFFFAOYSA-N
SMILES:FC1=C2C(=CNC2=CC=C1)C3CCC3
Synonyms:- 3-Cyclobutyl-4-fluoro-1H-indole
- 1H-Indole, 3-cyclobutyl-4-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
