
CAS 1707575-94-7
:1,3,8-Triazaspiro[4.5]dec-1-en-4-one, 2-cyclobutyl-, hydrochloride (1:1)
Description:
1,3,8-Triazaspiro[4.5]dec-1-en-4-one, 2-cyclobutyl-, hydrochloride (1:1) is a chemical compound characterized by its unique spirocyclic structure, which incorporates a triazole moiety and a cyclobutyl group. The presence of the triazole ring contributes to its potential biological activity, as triazoles are known for their role in various pharmacological applications. The hydrochloride salt form indicates that the compound is protonated, enhancing its solubility in polar solvents, which is often advantageous for biological assays and formulations. This compound may exhibit properties such as antimicrobial, antifungal, or anticancer activities, typical of many nitrogen-containing heterocycles. Its structural complexity allows for diverse interactions with biological targets, making it a subject of interest in medicinal chemistry. Additionally, the spirocyclic nature of the compound may influence its conformational flexibility and reactivity, which are critical factors in drug design and development. Overall, this compound represents a fascinating area of study within the field of organic and medicinal chemistry.
Formula:C11H17N3O·ClH
InChI:InChI=1S/C11H17N3O.ClH/c15-10-11(4-6-12-7-5-11)14-9(13-10)8-2-1-3-8;/h8,12H,1-7H2,(H,13,14,15);1H
InChI key:InChIKey=RSXBGYLGFPYJRJ-UHFFFAOYSA-N
SMILES:O=C1C2(NC(=N1)C3CCC3)CCNCC2.Cl
Synonyms:- 1,3,8-Triazaspiro[4.5]dec-1-en-4-one, 2-cyclobutyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.