CAS 1707580-78-6

Pyridine, 4-methoxy-2-(4-piperidinyloxy)-, hydrochloride (1:2)

Description:

Pyridine, 4-methoxy-2-(4-piperidinyloxy)-, hydrochloride (1:2) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a methoxy group and a piperidinyloxy substituent, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the piperidine moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the conditions under which it is studied. Additionally, safety data and handling precautions are essential due to the potential toxicity associated with nitrogen-containing heterocycles. Overall, this compound exemplifies the complexity and versatility of nitrogen-containing organic compounds in chemical research and development.

Formula: C₁₁H₁₆N₂O₂·2ClH

InChI: InChI=1S/C11H16N2O2.2ClH/c1-14-10-4-7-13-11(8-10)15-9-2-5-12-6-3-9;;/h4,7-9,12H,2-3,5-6H2,1H3;2*1H

InChI key: InChIKey=MZDVIZWCZCABLH-UHFFFAOYSA-N

SMILES: O(C1=CC(OC)=CC=N1)C2CCNCC2.Cl

Synonyms:

• Pyridine, 4-methoxy-2-(4-piperidinyloxy)-, hydrochloride (1:2)

4-Methoxy-2-(piperidin-4-yloxy)pyridinedihydrochloride

CAS: 1707580-78-6

Formula: C₁₁H₁₈Cl₂N₂O₂

Molecular weight: 281.18

Ref: 10-F330392