CAS 1707602-54-7

Ethyl 2-[(2-ethylphenyl)thio]propanoate

Description:

Ethyl 2-[(2-ethylphenyl)thio]propanoate is an organic compound characterized by its ester functional group, which is derived from the reaction of propanoic acid and ethanol. This compound features a thioether linkage, where a sulfur atom is bonded to a phenyl group, specifically a 2-ethylphenyl moiety, enhancing its chemical reactivity and potential applications. It typically appears as a colorless to pale yellow liquid with a distinctive odor. The presence of the ethyl group contributes to its solubility in organic solvents, while the thioether functionality may impart unique properties such as increased lipophilicity and potential biological activity. Ethyl 2-[(2-ethylphenyl)thio]propanoate may be utilized in various fields, including organic synthesis, fragrance formulation, and potentially in pharmaceuticals, although specific applications would depend on further research into its biological properties and reactivity. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₃H₁₈O₂S

InChI: InChI=1S/C13H18O2S/c1-4-11-8-6-7-9-12(11)16-10(3)13(14)15-5-2/h6-10H,4-5H2,1-3H3

InChI key: InChIKey=MEADZOCFQQGFJL-UHFFFAOYSA-N

SMILES: S(C(C(OCC)=O)C)C1=C(CC)C=CC=C1

Synonyms:

• Ethyl 2-[(2-ethylphenyl)thio]propanoate
• Propanoic acid, 2-[(2-ethylphenyl)thio]-, ethyl ester

Ethyl 2-(2-ethylphenyl)sulfanylpropanoate

CAS: 1707602-54-7

Formula: C₁₃H₁₈O₂S

Molecular weight: 238.35

Ref: 10-F095109