CAS 1707602-56-9

Pyrimidine, 4-(3-piperidinyloxy)-, hydrochloride (1:1)

Description:

Pyrimidine, 4-(3-piperidinyloxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a piperidinyloxy group at the 4-position of the pyrimidine enhances its potential biological activity, making it of interest in medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. This compound may exhibit properties such as being a potential ligand for various biological targets, and its structure suggests possible interactions with neurotransmitter systems. The hydrochloride form also aids in stabilizing the compound and improving its handling and formulation in drug development. Overall, the unique structural features of this compound contribute to its relevance in research and potential therapeutic applications.

Formula: C₉H₁₃N₃O·ClH

InChI: InChI=1S/C9H13N3O.ClH/c1-2-8(6-10-4-1)13-9-3-5-11-7-12-9;/h3,5,7-8,10H,1-2,4,6H2;1H

InChI key: InChIKey=JFXUWHIARSHERP-UHFFFAOYSA-N

SMILES: O(C1CCCNC1)C=2C=CN=CN2.Cl

Synonyms:

• Pyrimidine, 4-(3-piperidinyloxy)-, hydrochloride (1:1)

4-(Piperidin-3-yloxy)pyrimidine hydrochloride

CAS: 1707602-56-9

4-(Piperidin-3-yloxy)pyrimidine hydrochloride

Purity: ≥95%

Molecular weight: 215.68g/mol

Ref: 54-OR306623

4-(Piperidin-3-yloxy)pyrimidine hydrochloride

CAS: 1707602-56-9

Formula: C₉H₁₄ClN₃O

Molecular weight: 215.68

Ref: 10-F330415