CAS 1707602-60-5

1H-1,2,3-Triazole-4-carboxamide, 1-(4-piperidinyl)-, hydrochloride (1:1)

Description:

1H-1,2,3-Triazole-4-carboxamide, 1-(4-piperidinyl)-, hydrochloride (1:1) is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This compound features a carboxamide functional group, contributing to its potential as a bioactive molecule. The presence of the piperidine moiety enhances its pharmacological properties, often associated with increased solubility and biological activity. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications in medicinal chemistry. The compound may exhibit properties such as antimicrobial, antifungal, or anticancer activities, although specific biological effects would depend on further empirical studies. Its molecular structure allows for potential interactions with biological targets, making it a candidate for drug development. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₈H₁₄ClN₅O

InChI: InChI=1S/C8H13N5O.ClH/c9-8(14)7-5-13(12-11-7)6-1-3-10-4-2-6;/h5-6,10H,1-4H2,(H2,9,14);1H

InChI key: InChIKey=WELCKWABIFLGAS-UHFFFAOYSA-N

SMILES: C(N)(=O)C1=CN(N=N1)C2CCNCC2.Cl

Synonyms:

• 1H-1,2,3-Triazole-4-carboxamide, 1-(4-piperidinyl)-, hydrochloride (1:1)
• 1-(piperidin-4-yl)-1H-1,2,3-triazole-4-carboxamide hydrochloride

1-(Piperidin-4-yl)-1H-1,2,3-triazole-4-carboxamide hydrochloride

CAS: 1707602-60-5

Versatile small molecule scaffold

Formula: C₈H₁₄ClN₅O

Purity: Min. 95%

Molecular weight: 231.68 g/mol

Ref: 3D-HTC60260