CAS 1707602-61-6
:1,1-Dimethylethyl 4-amino-4-[(4-methoxyphenyl)methyl]-1-piperidinecarboxylate
Description:
1,1-Dimethylethyl 4-amino-4-[(4-methoxyphenyl)methyl]-1-piperidinecarboxylate, identified by its CAS number 1707602-61-6, is a chemical compound that features a piperidine ring, which is a six-membered nitrogen-containing heterocycle. This compound is characterized by the presence of a dimethyl group at the 1-position of the piperidine, contributing to its steric bulk and potentially influencing its biological activity. The amino group at the 4-position suggests that it may participate in hydrogen bonding, which can affect its solubility and reactivity. Additionally, the presence of a methoxyphenyl group indicates potential for aromatic interactions, which may enhance its binding affinity in biological systems. The carboxylate functionality suggests that it may exist in a deprotonated form under certain pH conditions, influencing its overall charge and solubility. Overall, this compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry and drug development.
Formula:C18H28N2O3
InChI:InChI=1S/C18H28N2O3/c1-17(2,3)23-16(21)20-11-9-18(19,10-12-20)13-14-5-7-15(22-4)8-6-14/h5-8H,9-13,19H2,1-4H3
InChI key:InChIKey=TYRGSTRYYLDUME-UHFFFAOYSA-N
SMILES:C(C1(N)CCN(C(OC(C)(C)C)=O)CC1)C2=CC=C(OC)C=C2
Synonyms:- 1-Piperidinecarboxylic acid, 4-amino-4-[(4-methoxyphenyl)methyl]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 4-amino-4-[(4-methoxyphenyl)methyl]-1-piperidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl 4-amino-4-(4-methoxybenzyl)piperidine-1-carboxylate
CAS:Formula:C18H28N2O3Molecular weight:320.433
