CAS 17078-28-3
:4-(dimethylamino)phenylacetic acid
Description:
4-(Dimethylamino)phenylacetic acid, with the CAS number 17078-28-3, is an organic compound characterized by its aromatic structure and the presence of both an amine and a carboxylic acid functional group. This compound features a phenyl ring substituted with a dimethylamino group at the para position and an acetic acid moiety. It is typically a white to off-white solid, soluble in polar solvents due to the presence of the carboxylic acid group, which can engage in hydrogen bonding. The dimethylamino group contributes to its basicity and can influence its reactivity and interaction with biological systems. This compound is of interest in various fields, including pharmaceuticals and organic synthesis, due to its potential as a building block for more complex molecules. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the conditions and the presence of other functional groups in a reaction. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C10H13NO2
InChI:InChI=1/C10H13NO2/c1-11(2)9-5-3-8(4-6-9)7-10(12)13/h3-6H,7H2,1-2H3,(H,12,13)
SMILES:CN(C)c1ccc(cc1)CC(=O)O
Synonyms:- 4-N,N-Dimethylaminophenylacetic acid
- 4-Dimethylaminophenylacetate
- Benzeneacetic acid, 4-(dimethylamino)-
- 4-(Dimethylamino)-benzeneacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzeneacetic acid, 4-(dimethylamino)-
CAS:Formula:C10H13NO2Purity:97%Color and Shape:SolidMolecular weight:179.21574-(Dimethylamino)phenylacetic acid
CAS:4-(Dimethylamino)phenylacetic acidFormula:C10H13NO2Purity:95%Color and Shape: off-white solidMolecular weight:179.22g/mol4-(Dimethylamino)phenylaceticacid
CAS:4-(Dimethylamino)phenylacetic acid (DMAPA) is a chemical inhibitor that binds to fatty acids. It has been shown to have antitumor effects on prostate cancer cells in vitro and in vivo, as well as anti-inflammatory properties. DMAPA also inhibits the synthesis of prostaglandins, which may be due to its binding to amines or the uv irradiation of the molecule. DMAPA has been shown to be effective in preventing the aggregation of serotonin receptors, which may play a role in its potential use for treating depression.Formula:C10H13NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:179.22 g/mol[4-(Dimethylamino)phenyl]acetic acid
CAS:Formula:C10H13NO2Purity:97%Color and Shape:CrystallineMolecular weight:179.219




