CymitQuimica logo

CAS 17078-76-1

:

4-ETHYL-4'-IODOBIPHENYL

Description:
4-Ethyl-4'-iodobiphenyl is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of an ethyl group at the para position of one phenyl ring and an iodine atom at the para position of the other ring contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit a yellowish to brownish color. It is relatively insoluble in water but soluble in organic solvents, which is common for biphenyl derivatives. The iodine substituent can influence the compound's reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the ethyl group can affect the steric and electronic properties of the molecule, potentially enhancing its reactivity in certain contexts. 4-Ethyl-4'-iodobiphenyl may find applications in organic synthesis, materials science, and as a precursor for more complex organic compounds. Safety precautions should be observed when handling this compound due to the presence of iodine, which can be hazardous.
Formula:C14H13I
InChI:InChI=1S/C14H13I/c1-2-11-3-5-12(6-4-11)13-7-9-14(15)10-8-13/h3-10H,2H2,1H3
InChI key:DUQFCMVIJVWQMX-UHFFFAOYSA-N
SMILES:CCC1=CC=C(C=C1)C2=CC=C(C=C2)I
Found 4 products.