CAS 170791-09-0: Trityl candesartan cilexetil
Description:Trityl candesartan cilexetil is a chemical compound that serves as a prodrug of candesartan, an angiotensin II receptor antagonist used primarily for the treatment of hypertension and heart failure. The compound is characterized by its trityl group, which enhances its lipophilicity and facilitates oral bioavailability. As a prodrug, trityl candesartan cilexetil undergoes enzymatic conversion in the body to release the active form, candesartan. This conversion is crucial for its pharmacological activity, as candesartan effectively blocks the action of angiotensin II, leading to vasodilation and reduced blood pressure. The compound is typically administered in tablet form and is known for its favorable pharmacokinetic profile, including a long half-life, which allows for once-daily dosing. Additionally, trityl candesartan cilexetil exhibits good solubility in organic solvents, making it suitable for various pharmaceutical formulations. Its safety and efficacy have been established through clinical studies, contributing to its use in managing cardiovascular conditions.
Formula:C52H48N6O6
InChI:InChI=1S/C52H48N6O6/c1-3-61-50-53-46-30-18-29-45(49(59)62-36(2)63-51(60)64-42-25-14-7-15-26-42)47(46)57(50)35-37-31-33-38(34-32-37)43-27-16-17-28-44(43)48-54-55-56-58(48)52(39-19-8-4-9-20-39,40-21-10-5-11-22-40)41-23-12-6-13-24-41/h4-6,8-13,16-24,27-34,36,42H,3,7,14-15,25-26,35H2,1-2H3
InChI key:InChIKey=MOHQWFWIPOOTGV-UHFFFAOYSA-N
SMILES:O=C(OC(OC(=O)C1=CC=CC=2N=C(OCC)N(C21)CC=3C=CC(=CC3)C=4C=CC=CC4C5=NN=NN5C(C=6C=CC=CC6)(C=7C=CC=CC7)C=8C=CC=CC8)C)OC9CCCCC9
- Synonyms:
- 1-(((Cyclohexyloxy)carbonyl)oxy)ethyl 2-ethoxy-1-((2′-(1-trityl-1H-tetrazol-5-yl)-[1,1′-biphenyl]-4-yl)methyl)-1H-benzo[d]imidazole-7-carboxylate
- 1-{[(Cyclohexyloxy)carbonyl]oxy}ethyl 2-ethoxy-1-{[2'-(1-trityl-1H-tetrazol-5-yl)biphenyl-4-yl]methyl}-1H-benzimidazole-7-carboxylate
- 1H-benzimidazole-7-carboxylic acid, 2-ethoxy-1-[[2'-[1-(triphenylmethyl)-1H-tetrazol-5-yl][1,1'-biphenyl]-4-yl]methyl]-, 1-[[(cyclohexyloxy)carbonyl]oxy]ethyl ester
- 2-Ethoxy-1-[(2′-(1-trityl-1H-tetrazol-5-yl)-1,1′-biphenyl-4-yl)methyl]-7-benzimidazolecarboxylic acid 1-(cyclohexyloxycarbonyloxy)ethyl ester
- N-Tritylcandesartan cilexetil
- Trityl candesartan cilexetil