CymitQuimica logo

CAS 170799-31-2

:

4-(Acetylamino)-N-[(4-acetyl-2-morpholinyl)methyl]-2-ethoxybenzamide

Description:
4-(Acetylamino)-N-[(4-acetyl-2-morpholinyl)methyl]-2-ethoxybenzamide, with the CAS number 170799-31-2, is a synthetic organic compound characterized by its complex molecular structure, which includes an aromatic ring, an acetylamino group, and a morpholine moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the ethoxy group suggests it may have enhanced lipophilicity, which can influence its pharmacokinetic properties. Additionally, the morpholine ring may contribute to its ability to interact with biological targets, potentially affecting its efficacy and safety profile. As with many compounds in medicinal chemistry, its specific characteristics, including melting point, boiling point, and reactivity, would depend on the purity and specific conditions under which it is studied. Overall, this compound represents a class of molecules that may have applications in drug development, particularly in targeting specific biological pathways.
Formula:C18H25N3O5
InChI:InChI=1S/C18H25N3O5/c1-4-25-17-9-14(20-12(2)22)5-6-16(17)18(24)19-10-15-11-21(13(3)23)7-8-26-15/h5-6,9,15H,4,7-8,10-11H2,1-3H3,(H,19,24)(H,20,22)
InChI key:InChIKey=VOYHAACPSNQVHU-UHFFFAOYSA-N
SMILES:C(NCC1CN(C(C)=O)CCO1)(=O)C2=C(OCC)C=C(NC(C)=O)C=C2
Synonyms:
  • 4-(Acetylamino)-N-[(4-acetyl-2-morpholinyl)methyl]-2-ethoxybenzamide
  • Benzamide, 4-(acetylamino)-N-[(4-acetyl-2-morpholinyl)methyl]-2-ethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.