CymitQuimica logo

CAS 170799-32-3

:

4-(Acetylamino)-N-[(4-acetyl-2-morpholinyl)methyl]-5-chloro-2-ethoxybenzamide

Description:
4-(Acetylamino)-N-[(4-acetyl-2-morpholinyl)methyl]-5-chloro-2-ethoxybenzamide, with the CAS number 170799-32-3, is a synthetic organic compound characterized by its complex molecular structure, which includes an acetylamino group, a morpholine moiety, and a chloro-substituted ethoxybenzamide framework. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the morpholine ring suggests possible interactions with biological targets, while the chloro and ethoxy groups may influence its lipophilicity and overall pharmacokinetic profile. Its synthesis involves multi-step reactions, often requiring careful control of reaction conditions to ensure the desired functional groups are preserved. As with many compounds in medicinal chemistry, its efficacy and safety profile would need to be evaluated through rigorous testing, including in vitro and in vivo studies, to determine its potential therapeutic applications.
Formula:C18H24ClN3O5
InChI:InChI=1S/C18H24ClN3O5/c1-4-26-17-8-16(21-11(2)23)15(19)7-14(17)18(25)20-9-13-10-22(12(3)24)5-6-27-13/h7-8,13H,4-6,9-10H2,1-3H3,(H,20,25)(H,21,23)
InChI key:InChIKey=DSSVQOSYYSRMCJ-UHFFFAOYSA-N
SMILES:C(NCC1CN(C(C)=O)CCO1)(=O)C2=C(OCC)C=C(NC(C)=O)C(Cl)=C2
Synonyms:
  • 4-(Acetylamino)-N-[(4-acetyl-2-morpholinyl)methyl]-5-chloro-2-ethoxybenzamide
  • Benzamide, 4-(acetylamino)-N-[(4-acetyl-2-morpholinyl)methyl]-5-chloro-2-ethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.