
CAS 1708-36-7
:2-Hexyl-1,3-dioxan-5-ol
Description:
2-Hexyl-1,3-dioxan-5-ol, with the CAS number 1708-36-7, is an organic compound characterized by its dioxane structure, which features a six-membered ring containing two oxygen atoms. This compound typically exhibits properties associated with alcohols, including the presence of a hydroxyl (-OH) group, which contributes to its solubility in polar solvents and potential reactivity in various chemical reactions. The hexyl group imparts hydrophobic characteristics, influencing its behavior in mixtures and applications. It is often utilized in the formulation of fragrances, cosmetics, and personal care products due to its pleasant odor and skin-conditioning properties. Additionally, the compound may exhibit low volatility and moderate stability under standard conditions, making it suitable for various industrial applications. Safety data should be consulted to understand its toxicity and handling requirements, as with any chemical substance. Overall, 2-Hexyl-1,3-dioxan-5-ol is a versatile compound with applications in both consumer products and chemical synthesis.
Formula:C10H20O3
InChI:InChI=1S/C10H20O3/c1-2-3-4-5-6-10-12-7-9(11)8-13-10/h9-11H,2-8H2,1H3
InChI key:InChIKey=ZIWLHBBLQRQFSA-UHFFFAOYSA-N
SMILES:C(CCCCC)C1OCC(O)CO1
Synonyms:- 1,3-Dioxan-5-ol, 2-hexyl-
- m-Dioxan-5-ol, 2-hexyl-
- 2-Hexyl-1,3-dioxan-5-ol
- Heptanal, cyclic 2-hydroxytrimethylene acetal
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Heptanal 1,3-glyceryl acetal
CAS:Heptanal 1,3-glyceryl acetal is a bioactive chemical.Formula:C10H20O3Color and Shape:SolidMolecular weight:188.26
