CAS 170804-18-9
:3-Amino-4,4,4-trifluorobutyric acid ethyl ester
Description:
3-Amino-4,4,4-trifluorobutyric acid ethyl ester is an organic compound characterized by the presence of an amino group, a trifluorobutyric acid moiety, and an ethyl ester functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. The trifluoromethyl group contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The amino group can participate in hydrogen bonding, making the compound potentially useful in various chemical reactions, including peptide synthesis and as a building block in pharmaceuticals. Its ethyl ester form suggests it may exhibit different solubility characteristics compared to its acid counterpart, enhancing its applicability in organic synthesis and medicinal chemistry. Additionally, the presence of fluorine atoms often imparts stability and alters the reactivity of the compound, making it of interest in the development of agrochemicals and pharmaceuticals. Safety data should be consulted for handling and storage, as fluorinated compounds can exhibit unique toxicological profiles.
Formula:C6H10F3NO2
InChI:InChI=1/C6H10F3NO2/c1-2-12-5(11)3-4(10)6(7,8)9/h4H,2-3,10H2,1H3
SMILES:CCOC(=O)CC(C(F)(F)F)N
Synonyms:- Ethyl 3-amino-4,4,4-trifluorobutyrate
- Ethyl 3-Amino-4,4,4-Trifluorobutanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ethyl 3-amino-4,4,4-trifluorobutyrate, 95%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C6H10F3NO2Purity:95%Color and Shape:Clear colorless, LiquidMolecular weight:185.15Ethyl 3-amino-4,4,4-trifluorobutanoate
CAS:Formula:C6H10F3NO2Color and Shape:LiquidMolecular weight:185.1443Ethyl 3-amino-4,4,4-trifluorobutanoate
CAS:<p>Ethyl 3-amino-4,4,4-trifluorobutanoate</p>Formula:C6H10F3NO2Purity:98%Color and Shape: clear liquidMolecular weight:185.14g/molEthyl-3-amino-4,4,4-trifluorobutyratehydrochloride
CAS:Formula:C6H11ClF3NO2Purity:95.0%Color and Shape:SolidMolecular weight:221.6



