CAS 17082-12-1
:(1E)-1,2-Diphenyldiazene
Description:
(1E)-1,2-Diphenyldiazene, also known as diphenyldiazene or azobenzene, is an organic compound characterized by its distinctive azo functional group (-N=N-) connecting two phenyl rings. This compound typically appears as a yellow to orange solid at room temperature and is known for its relatively stable structure under ambient conditions. It exhibits interesting photochemical properties, undergoing reversible isomerization between its E (trans) and Z (cis) forms upon exposure to ultraviolet light. The E form is generally more stable and predominant at room temperature. Diphenyldiazene is soluble in organic solvents such as ethanol, acetone, and chloroform, but has limited solubility in water. Its applications span various fields, including materials science, where it is used in the synthesis of dyes and polymers, and in photonics for light-responsive materials. Additionally, it serves as a model compound in studies of molecular switches and photochemical reactions. Safety precautions should be taken when handling this compound, as it may pose health risks upon exposure.
Formula:C12H10N2
InChI:InChI=1S/C12H10N2/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12/h1-10H/b14-13+
InChI key:InChIKey=DMLAVOWQYNRWNQ-BUHFOSPRSA-N
SMILES:N(=N/C1=CC=CC=C1)\C2=CC=CC=C2
Synonyms:- Diazene, diphenyl-, (1E)-
- Azobenzene, (E)-
- Diazene, 1,2-diphenyl-, (1E)-
- (1E)-1,2-Diphenyldiazene
- Diazene, diphenyl-, (E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
