
CAS 1708251-21-1
:Methyl 2-formyl-6-[(4-methoxyphenyl)methoxy]-3-pyridinecarboxylate
Description:
Methyl 2-formyl-6-[(4-methoxyphenyl)methoxy]-3-pyridinecarboxylate is an organic compound characterized by its complex structure, which includes a pyridine ring, a formyl group, and methoxy substituents. This compound features a methyl ester functional group, contributing to its reactivity and solubility in organic solvents. The presence of the pyridine ring imparts basicity and potential for coordination with metal ions, while the methoxyphenyl group enhances its lipophilicity and may influence its biological activity. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in various chemical reactions. Additionally, its unique arrangement of substituents may confer specific properties such as fluorescence or selective binding to biological targets. Overall, Methyl 2-formyl-6-[(4-methoxyphenyl)methoxy]-3-pyridinecarboxylate represents a versatile scaffold for further chemical modifications and investigations in both synthetic and applied chemistry contexts.
Formula:C16H15NO5
InChI:InChI=1S/C16H15NO5/c1-20-12-5-3-11(4-6-12)10-22-15-8-7-13(16(19)21-2)14(9-18)17-15/h3-9H,10H2,1-2H3
InChI key:InChIKey=CHZJZPZWWAYRQE-UHFFFAOYSA-N
SMILES:C(=O)C1=C(C(OC)=O)C=CC(OCC2=CC=C(OC)C=C2)=N1
Synonyms:- 3-Pyridinecarboxylic acid, 2-formyl-6-[(4-methoxyphenyl)methoxy]-, methyl ester
- Methyl 2-formyl-6-[(4-methoxyphenyl)methoxy]-3-pyridinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.