CAS 170847-18-4

1-Amino-2,3-dihydro-5-phosphono-1H-indene-1-carboxylic acid

Description:

1-Amino-2,3-dihydro-5-phosphono-1H-indene-1-carboxylic acid, commonly referred to as AP-5, is a synthetic compound that acts as a selective antagonist of the NMDA receptor, specifically targeting the glycine site. This compound is characterized by its unique indene structure, which incorporates both amino and phosphono functional groups, contributing to its biological activity. It is typically used in neuropharmacological research to study synaptic transmission and plasticity, particularly in the context of excitatory neurotransmission. The presence of the phosphono group enhances its solubility and stability in biological systems. AP-5 is known for its ability to inhibit the effects of glutamate, a key neurotransmitter, thereby providing insights into various neurological conditions and potential therapeutic applications. Its molecular structure allows for specific interactions with receptor sites, making it a valuable tool in the study of neurobiology. As with many chemical substances, proper handling and safety measures should be observed due to its biological activity.

Formula: C₁₀H₁₂NO₅P

InChI: InChI=1S/C10H12NO5P/c11-10(9(12)13)4-3-6-5-7(17(14,15)16)1-2-8(6)10/h1-2,5H,3-4,11H2,(H,12,13)(H2,14,15,16)

InChI key: InChIKey=ZNQZXIHSJUDIKL-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(N)C=2C(=CC(P(=O)(O)O)=CC2)CC1

Synonyms:

• Apica
• 1-Amino-2,3-dihydro-5-phosphono-1H-indene-1-carboxylic acid
• 1-Amino-5-phosphono-1-indanecarboxylic acid
• 1H-Indene-1-carboxylic acid, 1-amino-2,3-dihydro-5-phosphono-
• 1-Amino-5-phosphonoindane-1-carboxylic acid

rac-APICA

Controlled Product

CAS: 170847-18-4

Formula: C₁₀H₁₂NO₅P

Color and Shape: Neat

Molecular weight: 257.18

Ref: TR-A609148

(RS)-APICA

CAS: 170847-18-4

group II metabotropic glutamate receptor antagonist

Formula: C₁₀H₁₂NO₅P

Color and Shape: Solid

Molecular weight: 257.18

Ref: TM-T23268