CAS 170851-70-4
:Ipamorelin
Description:
Ipamorelin is a synthetic peptide that belongs to the class of growth hormone secretagogues (GHS). It is characterized by its ability to stimulate the release of growth hormone from the pituitary gland, making it of interest in various therapeutic and performance-enhancing contexts. Structurally, Ipamorelin consists of a sequence of amino acids, specifically designed to mimic the action of ghrelin, a natural hormone that regulates appetite and energy balance. Its mechanism of action involves binding to the growth hormone secretagogue receptor (GHS-R), leading to increased endogenous growth hormone levels without significantly affecting cortisol or prolactin levels, which is a notable advantage over other GHS. Ipamorelin is typically administered via subcutaneous injection and is known for its relatively short half-life, necessitating multiple doses for sustained effects. Additionally, it is often researched for its potential benefits in muscle growth, fat loss, and overall metabolic health, although its use in sports and bodybuilding raises ethical and regulatory considerations. As with any peptide, proper handling and storage are essential to maintain its stability and efficacy.
Formula:C38H49N9O5
InChI:InChI=1/C38H49N9O5/c1-38(2,41)37(52)47-32(21-28-22-42-23-43-28)36(51)46-31(20-25-15-16-26-12-6-7-13-27(26)18-25)35(50)45-30(19-24-10-4-3-5-11-24)34(49)44-29(33(40)48)14-8-9-17-39/h3-7,10-13,15-16,18,22-23,29-32H,8-9,14,17,19-21,39,41H2,1-2H3,(H2,40,48)(H,42,43)(H,44,49)(H,45,50)(H,46,51)(H,47,52)/t29-,30+,31+,32-/m0/s1
InChI key:NEHWBYHLYZGBNO-BVEPWEIPSA-N
SMILES:CC(C)(C(=O)N[C@@H](CC1=CN=CN1)C(=O)N[C@H](CC2=CC3=CC=CC=C3C=C2)C(=O)N[C@H](CC4=CC=CC=C4)C(=O)N[C@@H](CCCCN)C(=O)N)N
Synonyms:- Ipamorelin [INN]
- 2-Methylalanyl-L-histidyl-3-(2-naphthyl)-D-alanyl-D-phenylalanyl-L-lysinamide
- Unii-Y9M3S784Z6
- 2-methylalanyl-L-histidyl-3-naphthalen-2-yl-D-alanyl-D-phenylalanyl-L-lysinamide
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Ipamorelin
CAS:Ipamorelin (NNC-26-0161) is a growth-hormone-releasing peptide, induces longitudinal bone growth in rats.Formula:C38H49N9O5Color and Shape:SolidMolecular weight:711.85Ipamorelin
CAS:Formula:C38H49N9O5Purity:95%~99%Color and Shape:White to Off-white PowderMolecular weight:711.853Ipamorelin Acetate
CAS:Controlled ProductApplications Ipamorelin is a metabolite of growth hormone releasing peptides (GHRPs). Ipamorelin is a pentapeptide with strong growth hormone releasing potency that evokes insulin release from pancrease of normal and diabetic rats.
References Semenistaya, E., et al.: Drug Testing and Anal., 7, 919 (2015); Adeghate, E., et al.: Neuroendocrinol. Lett., 25, 403 (2004)Formula:C38H49N9O5x(C2H4O2)Color and Shape:NeatMolecular weight:711.856005





