
CAS 170856-57-2
:3-Ethoxy-N-methyl-N-[1-(phenylmethyl)-4-piperidinyl]-2-pyridinamine
Description:
3-Ethoxy-N-methyl-N-[1-(phenylmethyl)-4-piperidinyl]-2-pyridinamine, with CAS number 170856-57-2, is a chemical compound characterized by its complex structure, which includes a pyridine ring, an ethoxy group, and a piperidine moiety. This compound typically exhibits properties associated with its functional groups, such as moderate polarity due to the presence of the ethoxy and amine functionalities. It may display basic characteristics owing to the nitrogen atoms in the piperidine and pyridine rings, which can participate in protonation reactions. The presence of the phenylmethyl group contributes to its lipophilicity, potentially influencing its solubility in organic solvents. Additionally, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific reactivity, stability, and interaction with biological systems would require further empirical investigation to fully characterize its behavior in various environments.
Formula:C20H27N3O
InChI:InChI=1S/C20H27N3O/c1-3-24-19-10-7-13-21-20(19)22(2)18-11-14-23(15-12-18)16-17-8-5-4-6-9-17/h4-10,13,18H,3,11-12,14-16H2,1-2H3
InChI key:InChIKey=VNSBZWKWQFCKGO-UHFFFAOYSA-N
SMILES:N(C)(C1=C(OCC)C=CC=N1)C2CCN(CC3=CC=CC=C3)CC2
Synonyms:- 3-Ethoxy-N-methyl-N-[1-(phenylmethyl)-4-piperidinyl]-2-pyridinamine
- 2-Pyridinamine, 3-ethoxy-N-methyl-N-[1-(phenylmethyl)-4-piperidinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
U 101958
CAS:U 101958 is a putative antipsychotic agent It is also a highly selective dopamine D4 receptor antagonist.Formula:C20H27N3OColor and Shape:SolidMolecular weight:325.45
