
CAS 17086-03-2
:2-Naphthalenecarboxylic acid, 4,4′-methylenebis[3-hydroxy-, compd. with 3-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylidene)-N,N-dimethyl-1-propanamine (1:2)
Description:
2-Naphthalenecarboxylic acid, 4,4′-methylenebis[3-hydroxy-, compd. with 3-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylidene)-N,N-dimethyl-1-propanamine (1:2), identified by CAS number 17086-03-2, is a complex organic compound characterized by its multi-functional structure. It features a naphthalene backbone, which contributes to its aromatic properties, and includes carboxylic acid and hydroxy functional groups that enhance its reactivity and potential for hydrogen bonding. The presence of a methylene bridge indicates connectivity between two hydroxy-substituted naphthalene units, while the dibenzo compound introduces additional cyclic structures that may influence its physical and chemical properties. This compound may exhibit significant biological activity due to its intricate structure, making it of interest in medicinal chemistry and pharmacology. Its solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature, which are critical for applications in synthesis and formulation. Overall, this compound represents a unique intersection of aromatic chemistry and functional group diversity.
Formula:C23H16O6·2C20H23N
InChI:InChI=1S/C23H16O6.C20H23N/c24-20-16(14-7-3-1-5-12(14)9-18(20)22(26)27)11-17-15-8-4-2-6-13(15)10-19(21(17)25)23(28)29;1-21(2)15-7-12-20-18-10-5-3-8-16(18)13-14-17-9-4-6-11-19(17)20/h1-10,24-25H,11H2,(H,26,27)(H,28,29);3-6,8-12H,7,13-15H2,1-2H3
InChI key:InChIKey=FRYYNPIESGDSLC-UHFFFAOYSA-N
SMILES:C(C=1C2=C(C=C(C(O)=O)C1O)C=CC=C2)C=3C4=C(C=C(C(O)=O)C3O)C=CC=C4.C(CCN(C)C)=C1C=2C(CCC=3C1=CC=CC3)=CC=CC2
Synonyms:- Amitriptyline pamoate
- 2-Naphthoic acid, 4,4′-methylenebis[3-hydroxy-, compd. with 10,11-dihydro-N,N-dimethyl-5H-dibenzo[a,d]cycloheptene-Δ5,γ-propylamine (1:2)
- 2-Naphthalenecarboxylic acid, 4,4′-methylenebis[3-hydroxy-, compd. with 3-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylidene)-N,N-dimethyl-1-propanamine (1:2)
- 1-Propanamine, 3-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylidene)-N,N-dimethyl-, 4,4′-methylenebis[3-hydroxy-2-naphthalenecarboxylate] (2:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Amitriptyline Embonate
CAS:Amitriptyline Embonate is an inhibitor of the re-uptake of norepinephrine and serotonin, thereby inhibiting N-methyl-D-aspartate (NMDA) receptors.Formula:C63H62N2O6Color and Shape:SolidMolecular weight:943.2
