CAS 170861-45-7

2-Thiophenemethanol,3-amino-(9CI)

Description:

2-Thiophenemethanol, 3-amino- (9CI), with the CAS number 170861-45-7, is an organic compound characterized by the presence of a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features a hydroxymethyl group (-CH2OH) and an amino group (-NH2) attached to the thiophene structure, contributing to its potential reactivity and solubility in various solvents. The presence of the amino group suggests that it may participate in hydrogen bonding and could act as a nucleophile in chemical reactions. Additionally, the hydroxymethyl group can serve as a site for further functionalization, making this compound of interest in synthetic organic chemistry and medicinal chemistry. Its unique structure may impart specific biological activities, which could be explored in pharmaceutical applications. Overall, 2-Thiophenemethanol, 3-amino- is a versatile compound with potential uses in various chemical and biological contexts.

Formula: C₅H₇NOS

InChI: InChI=1/C5H7NOS/c6-4-1-2-8-5(4)3-7/h1-2,7H,3,6H2

SMILES: c1csc(CO)c1N

Synonyms:

• (3-Amino-2-thienyl)methanol
• (3-Aminothiophen-2-Yl)Methanol

2-Thiophenemethanol,3-amino-(9CI)

CAS: 170861-45-7

Formula: C₅H₇NOS

Purity: 95%

Molecular weight: 129.1802

Ref: IN-DA00ABQ9

3-Amino-2-(hydroxymethyl)thiophene

CAS: 170861-45-7

3-Amino-2-(hydroxymethyl)thiophene

Purity: 98%

Molecular weight: 129.18g/mol

Ref: 54-OR85819

(3-Aminothiophen-2-yl)methanol

CAS: 170861-45-7

Formula: C₅H₇NOS

Purity: 98%

Molecular weight: 129.18

Ref: 10-F459889