CAS 17088-22-1
:1-ETHYLPYRENE
Description:
1-Ethylpyrene is an organic compound belonging to the polycyclic aromatic hydrocarbons (PAHs) family, characterized by its fused aromatic rings. It is a derivative of pyrene, with an ethyl group attached to one of the carbon atoms in the pyrene structure. This compound is typically a colorless to pale yellow solid at room temperature and is known for its hydrophobic nature, making it poorly soluble in water but soluble in organic solvents. 1-Ethylpyrene exhibits fluorescence properties, which can be utilized in various analytical applications. It is primarily studied for its potential environmental impact, as PAHs are known to be persistent pollutants and can pose health risks due to their carcinogenic properties. The compound's behavior in biological systems and its interactions with other chemicals are of interest in toxicology and environmental chemistry. Safety precautions are necessary when handling 1-ethylpyrene, as with other PAHs, due to its potential health hazards.
Formula:C18H14
InChI:InChI=1/C18H14/c1-2-12-6-7-15-9-8-13-4-3-5-14-10-11-16(12)18(15)17(13)14/h3-11H,2H2,1H3
Synonyms:- 1-Ethylpyrene
- Pyrene, 1-ethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.