CAS 1709-44-0
:3-Aminobenzaldehyde
Description:
3-Aminobenzaldehyde, also known as meta-aminobenzaldehyde, is an organic compound characterized by the presence of both an amino group (-NH2) and an aldehyde group (-CHO) attached to a benzene ring. Its molecular formula is C7H7N O, and it features a phenyl ring with the amino group positioned at the meta position relative to the aldehyde. This compound is typically a pale yellow to light brown solid at room temperature and is soluble in polar solvents such as water and alcohols due to the presence of the amino group. 3-Aminobenzaldehyde is utilized in various applications, including as an intermediate in the synthesis of pharmaceuticals, dyes, and agrochemicals. It can undergo typical reactions associated with aldehydes, such as oxidation and condensation, and can also participate in nucleophilic substitution reactions due to the reactivity of the amino group. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C7H7NO
InChI:InChI=1S/C7H7NO/c8-7-3-1-2-6(4-7)5-9/h1-5H,8H2
InChI key:InChIKey=SIXYIEWSUKAOEN-UHFFFAOYSA-N
SMILES:C(=O)C1=CC(N)=CC=C1
Synonyms:- 3-Aminobenzaldehyde
- 3-Formylaniline
- Benzaldehyde, 3-amino-
- Benzaldehyde, m-amino-
- NSC 36957
- m-Aminobenzaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
