CAS 170911-68-9
:4-[4-[2-[3-(2-Aminoethyl)-1H-indol-5-yloxy]acetyl]piperazin-1-yl]benzonitrile hydrochloride
Description:
4-[4-[2-[3-(2-Aminoethyl)-1H-indol-5-yloxy]acetyl]piperazin-1-yl]benzonitrile hydrochloride, with the CAS number 170911-68-9, is a synthetic organic compound characterized by its complex structure, which includes an indole moiety, a piperazine ring, and a benzonitrile group. This compound is typically classified as a pharmaceutical intermediate or a potential drug candidate, often investigated for its biological activity, particularly in the context of neuropharmacology or oncology. The presence of the aminoethyl group suggests potential interactions with biological targets, possibly influencing receptor binding or enzyme activity. As a hydrochloride salt, it is likely to exhibit improved solubility in aqueous environments, which is advantageous for pharmacological applications. The compound's synthesis and characterization would involve standard organic chemistry techniques, including chromatography and spectroscopy, to confirm its purity and structural integrity. Overall, its unique structural features may contribute to its pharmacological properties, making it a subject of interest in medicinal chemistry research.
Formula:C23H26ClN5O2
InChI:InChI=1/C23H25N5O2.ClH/c24-8-7-18-15-26-22-6-5-20(13-21(18)22)30-16-23(29)28-11-9-27(10-12-28)19-3-1-17(14-25)2-4-19;/h1-6,13,15,26H,7-12,16,24H2;1H
SMILES:c1cc(ccc1C#N)N1CCN(CC1)C(=O)COc1ccc2c(c1)c(CCN)c[nH]2.Cl
Synonyms:- Donitriptan hydrochloride
- F-11356
- 4-[4-({[3-(2-aminoethyl)-1H-indol-5-yl]oxy}acetyl)piperazin-1-yl]benzonitrile hydrochloride (1:1)
- Donitriptan
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Donitriptan hydrochloride
CAS:Donitriptan hydrochloride (Donitriptan monohydrochloride) is a potent, high efficacy agonist of 5-HT1B/1D receptors with pKis of 9.4 and 9.3, respectivelyFormula:C23H26ClN5O2Purity:99.8% - 99.86%Color and Shape:SolidMolecular weight:439.94Ref: TM-T21666
2mg40.00€5mg49.00€10mg64.00€25mg135.00€50mg240.00€100mg339.00€200mg439.00€500mgTo inquireDonitriptan Hydrochloride
CAS:Applications A novel 5-hydroxytryptamine (5-HT) derivative with potent, selective, and unique high intrinsic activity at 5-HT1B/1D receptors in models relevant to migraine. An antimigraine agent.
References Pauwels, P., et al.: Biochem. Pharmacol., 46, 535 (1993), Kleven, M., et al.: Eur. J. Pharmacol., 281, 219 (1995), Perez, M., et al.: J. Med. Chem., 38, 3602 (1995), Le Grand, B., et al.: J. Cardiovasc. Pharmacol., 32, 435 (1998),Formula:C23H25N5O2·HClColor and Shape:NeatMolecular weight:439.94Donitriptan hydrochloride
CAS:Controlled ProductSerotonin receptor (5-HT1B/1D) agonistPurity:Min. 95%


