CymitQuimica logo

CAS 170918-28-2

:

1H-Benzimidazole,4-methyl-5-nitro-(9CI)

Description:
1H-Benzimidazole, 4-methyl-5-nitro- (CAS 170918-28-2) is a heterocyclic organic compound characterized by a benzimidazole core structure, which consists of a fused benzene and imidazole ring. The presence of a methyl group at the 4-position and a nitro group at the 5-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water, depending on the specific conditions. It is often studied for its potential biological activities, including antimicrobial and anticancer properties, due to the presence of the nitro group, which can participate in various chemical reactions. The compound's stability can be influenced by factors such as pH and temperature, and it may undergo various transformations under different conditions. As with many nitro-containing compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Overall, 1H-benzimidazole, 4-methyl-5-nitro- is of interest in both synthetic and medicinal chemistry.
Formula:C8H7N3O2
InChI:InChI=1S/C8H7N3O2/c1-5-7(11(12)13)3-2-6-8(5)10-4-9-6/h2-4H,1H3,(H,9,10)
InChI key:InChIKey=OUNJNOIRCNXHMH-UHFFFAOYSA-N
SMILES:CC1=C2C(=CC=C1N(=O)=O)N=CN2
Synonyms:
  • 4-Methyl-5-nitrobenzimidazole
  • 1H-Benzimidazole, 4-methyl-5-nitro-
  • 1H-Benzimidazole, 7-methyl-6-nitro-
  • 7-Methyl-6-nitro-1H-benzimidazole
  • 4-methyl-5-nitro-1H-benzimidazole
  • 1H-Benzimidazole,4-methyl-5-nitro-(9CI)
Found 3 products.