CAS 1710-62-9
:5-(2-BROMOETHOXY)-2,3-DIHYDRO-1,4-BENZODIOXINE
Description:
5-(2-Bromoethoxy)-2,3-dihydro-1,4-benzodioxine, with the CAS number 1710-62-9, is a chemical compound characterized by its unique structural features, including a benzodioxine core and a bromoethoxy substituent. This compound typically exhibits a molecular structure that includes a fused dioxine ring, contributing to its potential reactivity and interaction with biological systems. The presence of the bromine atom enhances its electrophilic character, making it a candidate for various chemical reactions, including nucleophilic substitutions. Its dihydro form suggests that it may exist in a saturated state, influencing its physical properties such as solubility and boiling point. The compound may also exhibit specific biological activities, which could be of interest in medicinal chemistry and pharmacology. However, detailed studies on its toxicity, stability, and reactivity are essential for understanding its practical applications and safety profile. As with many organic compounds, proper handling and storage conditions are crucial to maintain its integrity and prevent degradation.
Formula:C10H11BrO3
InChI:InChI=1/C10H11BrO3/c11-4-5-12-8-2-1-3-9-10(8)14-7-6-13-9/h1-3H,4-7H2
SMILES:c1cc(c2c(c1)OCCO2)OCCBr
Synonyms:- 5-(2-Bromoethoxy)-1,4-Benzodioxane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-(2-Bromoethoxy)-2,3-dihydro-1,4-benzodioxine
CAS:Formula:C10H11BrO3Purity:95%Color and Shape:SolidMolecular weight:259.09655-(2-Bromoethoxy)-2,3-dihydro-1,4-benzodioxine
CAS:5-(2-Bromoethoxy)-2,3-dihydro-1,4-benzodioxinePurity:97%Color and Shape:White SolidMolecular weight:259.10g/mol5-(2-Bromoethoxy)-2,3-dihydro-1,4-benzodioxine
CAS:5-(2-Bromoethoxy)-2,3-dihydro-1,4-benzodioxine is a drug that belongs to the group of local anesthetics. It blocks nerve conduction by inhibiting voltage-gated sodium channels and is used for the treatment of pain. 5-(2-Bromoethoxy)-2,3-dihydro-1,4-benzodioxine has been shown to have two dimensional energies that are greater than those of other drugs in this category. The interactions between molecules are isomorphous and there are strong hydrogen bonds. 5-(2-Bromoethoxy)-2,3-dihydro-1,4-benzodioxine also interacts with the interatomic distance between hydrogens and bromines on adjacent molecules.Formula:C10H11BrO3Purity:Min. 95%Molecular weight:259.1 g/mol5-(2-Bromoethoxy)-2,3-dihydro-1,4-benzodioxine
CAS:Formula:C10H11BrO3Purity:97.0%Molecular weight:259.099



