CAS 17102-63-5

4-Bromo-2-Methoxybenzyl Alcohol

Description:

4-Bromo-2-Methoxybenzyl Alcohol, with the CAS number 17102-63-5, is an organic compound characterized by the presence of a bromine atom and a methoxy group attached to a benzyl alcohol structure. This compound features a benzene ring substituted with a bromine atom at the para position and a methoxy group at the ortho position relative to the benzyl alcohol functional group. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the hydroxyl (-OH) group contributes to its solubility in polar solvents, while the methoxy group enhances its reactivity in various chemical reactions, such as nucleophilic substitutions and coupling reactions. 4-Bromo-2-Methoxybenzyl Alcohol may be used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Its bromine substituent can also facilitate further functionalization, making it a valuable intermediate in synthetic chemistry. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₈H₉BrO₂

InChI: InChI=1/C8H9BrO2/c1-11-8-4-7(9)3-2-6(8)5-10/h2-4,10H,5H2,1H3

SMILES: COc1cc(ccc1CO)Br

Synonyms:

• (4-Bromo-2-Methoxyphenyl)Methanol

4-BROMO-2-METHOXYBENZYL ALCOHOL 97

CAS: 17102-63-5

Formula: C₈H₉BrO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 217.0599

Ref: IN-DA003KX2

(4-Bromo-2-methoxyphenyl)methanol

CAS: 17102-63-5

(4-Bromo-2-methoxyphenyl)methanol

Purity: 97%

Molecular weight: 217.06g/mol

Ref: 54-OR74666

(4-Bromo-2-methoxyphenyl)methanol

CAS: 17102-63-5

Formula: C₈H₉BrO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 217.062

Ref: 10-F233880