CAS 171047-01-1
:3-(3-Hydroxyphenyl)benzoic acid
Description:
3-(3-Hydroxyphenyl)benzoic acid, also known as a derivative of benzoic acid, features a phenolic hydroxyl group and a carboxylic acid functional group, which contribute to its chemical properties. This compound typically appears as a solid at room temperature and is characterized by its aromatic structure, which enhances its stability and reactivity. The presence of the hydroxyl group allows for hydrogen bonding, influencing its solubility in polar solvents. It may exhibit moderate solubility in water and higher solubility in organic solvents. The compound can participate in various chemical reactions, including esterification and acylation, making it useful in organic synthesis and materials science. Additionally, due to its structural features, it may possess biological activity, potentially serving as a precursor in pharmaceuticals or agrochemicals. Its melting point, boiling point, and specific reactivity would depend on the conditions and purity of the substance. Overall, 3-(3-Hydroxyphenyl)benzoic acid is a versatile compound with applications in various fields of chemistry.
Formula:C13H10O3
InChI:InChI=1/C13H10O3/c14-12-6-2-4-10(8-12)9-3-1-5-11(7-9)13(15)16/h1-8,14H,(H,15,16)
SMILES:c1cc(cc(c1)C(=O)O)c1cccc(c1)O
Synonyms:- [1,1'-Biphenyl]-3-carboxylic acid, 3'-hydroxy-
- 3'-Hydroxybiphenyl-3-carboxylic acid
- 3-(3-Hydroxyphenyl)benzoic acid
- 3'-Hydroxy-[1,1'-biphenyl]-3-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3'-Hydroxybiphenyl-3-carboxylic acid
CAS:Formula:C13H10O3Purity:97%Color and Shape:SolidMolecular weight:214.21673'-Hydroxy-[1,1'-biphenyl]-3-carboxylic acid
CAS:3'-Hydroxy-[1,1'-biphenyl]-3-carboxylic acidPurity:97%Molecular weight:214.22g/mol3′-Hydroxy-biphenyl-3-carboxylic acid
CAS:Formula:C13H10O3Purity:95.0%Color and Shape:SolidMolecular weight:214.223'-Hydroxy-biphenyl-3-carboxylic acid
CAS:3'-Hydroxy-biphenyl-3-carboxylic acid is a mitochondrial membrane depolarizing agent that has been shown to have anticancer potential in mammalian cells. It causes hypertrophy and population growth in stromal tumors and has been shown to inhibit the enzyme responsible for inflammatory pain, pancreatic cancer cell lines, and tumour cell lines. 3'-Hydroxy-biphenyl-3-carboxylic acid also interacts with viral DNA and prevents replication of the virus. 3'-Hydroxy-biphenyl-3-carboxylic acid can be conjugated to nucleosides or nucleotides, which may make it more effective as an anticancer agent than other agents.Formula:C13H10O3Purity:Min. 95%Molecular weight:214.22 g/mol



