CAS 171058-17-6
:1-Hexyl-3-methylimidazolium chloride
Description:
1-Hexyl-3-methylimidazolium chloride is an ionic liquid characterized by its unique structure and properties. It features a long hydrophobic hexyl chain and a methyl group attached to the imidazolium ring, which contributes to its amphiphilic nature. This compound typically exhibits a low melting point, allowing it to remain in a liquid state at room temperature, which is a hallmark of ionic liquids. Its ionic nature imparts high thermal stability and low volatility, making it an attractive solvent for various chemical reactions and processes. Additionally, 1-Hexyl-3-methylimidazolium chloride is known for its ability to dissolve a wide range of organic and inorganic materials, enhancing its utility in applications such as catalysis, extraction, and electrochemistry. The chloride anion can also influence its solvation properties and interactions with other substances. Overall, this ionic liquid is valued for its tunable properties, which can be adjusted by modifying the alkyl chain length or the anion, making it versatile for various industrial and research applications.
Formula:C10H19N2
InChI:InChI=1/C10H19N2/c1-3-4-5-6-7-12-9-8-11(2)10-12/h8-10H,3-7H2,1-2H3/q+1
SMILES:CCCCCCN1C=CN(C)[CH]1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1-Hexyl-3-methylimidazolium Chloride
CAS:Formula:C10H19ClN2Purity:>98.0%(T)Color and Shape:Colorless to Yellow clear liquidMolecular weight:202.731-n-Hexyl-3-methylimidazolium chloride, 98%
CAS:1-n-Hexyl-3-methylimidazolium chloride, is used as an important raw material and intermediate used in organic Synthesis, pharmaceuticals, agrochemicals and dyestuff. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label
Formula:C10H19N2Purity:98%Color and Shape:Clear colorless to yellow to orange, Liquid or viscous liquidMolecular weight:167.281-Hexyl-3-methylimidazolium chloride
CAS:Formula:C10H19ClN2Purity:97%Color and Shape:LiquidMolecular weight:202.72431-Hexyl-3-methylimidazolium Chloride
CAS:1-Hexyl-3-methylimidazolium ChloridePurity:99%Molecular weight:202.72g/mol1-Hexyl-3-methylimidazolium chloride
CAS:Formula:C10H19ClN2Purity:98%Color and Shape:Liquid, No data available.Molecular weight:202.73




