CAS 17106-13-7
:2,4-Dimethylpyrrole-3-carboxylicacid
Description:
2,4-Dimethylpyrrole-3-carboxylic acid is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features two methyl groups at the 2 and 4 positions of the pyrrole ring and a carboxylic acid functional group at the 3 position, contributing to its acidic properties. The presence of the carboxylic acid group allows for potential hydrogen bonding and increases its solubility in polar solvents. This compound is typically used in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals or agrochemicals. Its molecular structure suggests it may exhibit interesting reactivity due to the electron-donating effects of the methyl groups and the electron-withdrawing nature of the carboxylic acid. Additionally, the compound's properties, such as melting point, boiling point, and stability, can vary based on environmental conditions and the presence of other functional groups in a reaction mixture. Overall, 2,4-Dimethylpyrrole-3-carboxylic acid is a versatile compound with potential applications in various chemical fields.
Formula:C7H9NO2
InChI:InChI=1/C7H9NO2/c1-4-3-8-5(2)6(4)7(9)10/h3,8H,1-2H3,(H,9,10)
InChI key:InChIKey=XBPJVSRTTKVMEN-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(C)=CNC1C
Synonyms:- 1H-Pyrrole-3-carboxylic acid, 2,4-dimethyl-
- 1H-Pyrrole-3-carboxylicacid,2,4-dimethyl-(9CI)
- 2,4-Dimethyl-1H-Pyrrole-3-Carboxylic Acid
- Pyrrole-3-carboxylic acid, 2,4-dimethyl-
- 2,4-Dimethylpyrrole-3-carboxylicacid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,4-Dimethylpyrrole-3-carboxylic acid
CAS:2,4-Dimethylpyrrole-3-carboxylic acidFormula:C7H9NO2Purity:98%Color and Shape: red solidMolecular weight:139.15g/mol2,4-Dimethylpyrrole-3-carboxylic acid
CAS:2,4-Dimethylpyrrole-3-carboxylic acid is a pyrrole that has been used for the industrial production of polymers. It has been shown to have anticancer activity against human cancer cells in vitro and in vivo. 2,4-Dimethylpyrrole-3-carboxylic acid is also able to inhibit nitrite production from the reaction of nitrite with amines. It binds to adenosine receptors and inhibits the growth of kidney cells. This compound may be useful in the treatment of cancer due to its pharmacokinetic properties and its ability to bind selectively to cancer cells.Formula:C7H9NO2Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:139.15 g/mol2,4-Dimethylpyrrole-3-carboxylic acid
CAS:Formula:C7H9NO2Purity:95%Color and Shape:Liquid, No data available.Molecular weight:139.154



