CAS 171096-34-7

Methyl 4-chloro-6-methoxy-5-pyrimidineacetate

Description:

Methyl 4-chloro-6-methoxy-5-pyrimidineacetate is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a methoxy group (-OCH3) at the 6-position and a chloro group (-Cl) at the 4-position contributes to its unique reactivity and potential biological activity. The acetate functional group indicates that it is an ester, which can influence its solubility and stability. This compound may exhibit properties typical of pyrimidine derivatives, such as potential use in pharmaceuticals or agrochemicals, owing to the biological significance of pyrimidine structures. Its molecular interactions can be influenced by the electronegative chlorine atom and the methoxy group, which can affect its polarity and reactivity. Overall, Methyl 4-chloro-6-methoxy-5-pyrimidineacetate is of interest in various fields, including medicinal chemistry and material science, due to its structural features and potential applications.

Formula: C₈H₉ClN₂O₃

InChI: InChI=1S/C8H9ClN2O3/c1-13-6(12)3-5-7(9)10-4-11-8(5)14-2/h4H,3H2,1-2H3

InChI key: InChIKey=LQRCZEMNPQCPCO-UHFFFAOYSA-N

SMILES: C(C(OC)=O)C=1C(OC)=NC=NC1Cl

Synonyms:

• 5-Pyrimidineacetic acid, 4-chloro-6-methoxy-, methyl ester
• Methyl 4-chloro-6-methoxy-5-pyrimidineacetate

methyl 2-(4-chloro-6-methoxypyrimidin-5-yl)acetate

CAS: 171096-34-7

Formula: C₈H₉ClN₂O₃

Purity: 95.0%

Molecular weight: 216.62

Ref: 10-F496297