CAS 17114-97-5
:H-Ser(tBu)-OMe . HCl
Description:
H-Ser(tBu)-OMe·HCl, also known as t-butyl protected serine methyl ester hydrochloride, is a chemical compound that serves as a derivative of the amino acid serine. It features a t-butyl group that provides steric protection to the hydroxyl group of serine, enhancing its stability during chemical reactions. The methyl ester group allows for easier handling and incorporation into peptide synthesis. The presence of hydrochloride indicates that the compound is in its salt form, which typically enhances solubility in polar solvents. This compound is often utilized in peptide synthesis and other organic chemistry applications due to its ability to protect functional groups while allowing for selective reactions. Its structure includes a central carbon atom bonded to an amino group, a carboxyl group (in ester form), and a hydroxyl group, making it a versatile building block in the synthesis of more complex molecules. As with many chemical substances, proper handling and storage conditions are essential to maintain its stability and reactivity.
Formula:C8H18ClNO3
InChI:InChI=1/C8H17NO3.ClH/c1-8(2,3)12-5-6(9)7(10)11-4;/h6H,5,9H2,1-4H3;1H/t6-;/m1./s1
SMILES:CC(C)(C)OC[C@H](C(=O)OC)N.Cl
Synonyms:- H-Ser(But)-OMe*HCl
- L-(O-tert-Bu)-Ser-OMe HCl
- (2S)-3-tert-butoxy-1-methoxy-1-oxopropan-2-aminium chloride
- methyl O-tert-butyl-D-serinate hydrochloride (1:1)
- O-Tert-Butyl-L-Serine Methyl Ester Hydrochloride
- H-Ser(tBu)-OMe・HCl
- H-Ser(tBu)-OMe.HCl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
O-tert-Butyl-L-serine methyl ester hydrochloride, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H18ClNO3Purity:98%Molecular weight:211.69H-Ser(tBu)-OMe · HCl
CAS:Educt for the synthesis of heterocyclic serine dipeptide analogs.Formula:C8H17NO3·HClPurity:> 99%Color and Shape:WhiteMolecular weight:211.69O-tert-butyl-L-serine methyl ester hydrochloride
CAS:O-tert-butyl-L-serine methyl ester hydrochloridePurity:98%Color and Shape:SolidMolecular weight:211.69g/molO-tert-Butyl-L-serine Methyl Ester Hydrochloride
CAS:Formula:C8H17NO3·HClPurity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:211.69H-Ser(tBu)-OMe.HCl
CAS:M03004 - H-Ser(tBu)-OMe.HCl
Formula:C8H18ClNO3Purity:95%Color and Shape:SolidMolecular weight:211.69






